About 1-bromo-2H-1,10-phenanthroline
1-bromo-2H-1,10-phenanthroline (PubChem CID 163209709) has the molecular formula C12H9BrN2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 1-bromo-2H-1,10-phenanthroline.
Molecular Properties
| Compound Name | 1-bromo-2H-1,10-phenanthroline |
| PubChem CID | 163209709 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1-bromo-2H-1,10-phenanthroline |
| SMILES | BrN1CC=Cc2ccc3cccnc3c21 |
| InChI | InChI=1S/C12H9BrN2/c13-15-8-2-4-10-6-5-9-3-1-7-14-11(9)12(10)15/h1-7H,8H2 |
| InChIKey | JORKIIDXGYVZRQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2H-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2H-1,10-phenanthroline?
The IUPAC name of 1-bromo-2H-1,10-phenanthroline (CID 163209709) is 1-bromo-2H-1,10-phenanthroline.
What is the SMILES notation for 1-bromo-2H-1,10-phenanthroline?
The canonical SMILES for 1-bromo-2H-1,10-phenanthroline is BrN1CC=Cc2ccc3cccnc3c21.
What is the InChIKey of 1-bromo-2H-1,10-phenanthroline?
The InChIKey is JORKIIDXGYVZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN2/c13-15-8-2-4-10-6-5-9-3-1-7-14-11(9)12(10)15/h1-7H,8H2.
What are the key properties of 1-bromo-2H-1,10-phenanthroline?
1-bromo-2H-1,10-phenanthroline has a molecular weight of 261.12 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2H-1,10-phenanthroline is sourced from PubChem (CID 163209709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).