C31H32FNO4 — CID 123477338
8-[[2-fluoro-5-[4-(4-hydroxy-4-methylpentyl)-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid (PubChem CID 123477338) has the molecular formula C31H32FNO4 and a molecular weight of 501.60 g/mol. Its IUPAC name is 8-[[2-fluoro-5-[4-(4-hydroxy-4-methylpentyl)-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid.
| Compound Name | 8-[[2-fluoro-5-[4-(4-hydroxy-4-methylpentyl)-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 123477338 |
| Molecular Formula | C31H32FNO4 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 8-[[2-fluoro-5-[4-(4-hydroxy-4-methylpentyl)-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid |
| SMILES | Cc1cc(CCCC(C)(C)O)cc(C)c1-c1ccc(F)c(COc2cc3c(cn2)C2=C(C(=O)O)C2C3)c1 |
| InChI | InChI=1S/C31H32FNO4/c1-17-10-19(6-5-9-31(3,4)36)11-18(2)27(17)20-7-8-25(32)22(12-20)16-37-26-14-21-13-23-28(24(21)15-33-26)29(23)30(34)35/h7-8,10-12,14-15,23,36H,5-6,9,13,16H2,1-4H3,(H,34,35) |
| InChIKey | XBBXITUJJURTEA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |