C28H24F2N2O4 — CID 126708068
(4R)-8-[[5-fluoro-1-(2-fluoro-5-methoxyphenyl)-3,3-dimethyl-2H-indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid (PubChem CID 126708068) has the molecular formula C28H24F2N2O4 and a molecular weight of 490.51 g/mol. Its IUPAC name is (4R)-8-[[5-fluoro-1-(2-fluoro-5-methoxyphenyl)-3,3-dimethyl-2H-indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid.
| Compound Name | (4R)-8-[[5-fluoro-1-(2-fluoro-5-methoxyphenyl)-3,3-dimethyl-2H-indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 126708068 |
| Molecular Formula | C28H24F2N2O4 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (4R)-8-[[5-fluoro-1-(2-fluoro-5-methoxyphenyl)-3,3-dimethyl-2H-indol-6-yl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),2,6,8-tetraene-3-carboxylic acid |
| SMILES | COc1ccc(F)c(N2CC(C)(C)c3cc(F)c(COc4cc5c(cn4)C4=C(C(=O)O)[C@@H]4C5)cc32)c1 |
| InChI | InChI=1S/C28H24F2N2O4/c1-28(2)13-32(23-9-16(35-3)4-5-20(23)29)22-7-15(21(30)10-19(22)28)12-36-24-8-14-6-17-25(18(14)11-31-24)26(17)27(33)34/h4-5,7-11,17H,6,12-13H2,1-3H3,(H,33,34)/t17-/m1/s1 |
| InChIKey | QRWTUCYYYBOAAL-QGZVFWFLSA-N |
| XLogP | 5.40 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |