C18H27N5O4 — CID 123478224
1-[[5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-hydroxypyrrolidin-2-yl]methoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 123478224) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[[5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-hydroxypyrrolidin-2-yl]methoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[[5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-hydroxypyrrolidin-2-yl]methoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123478224 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[[5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-hydroxypyrrolidin-2-yl]methoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(OCC1CC(O)C(c2c[nH]c3c(N)ncnc23)N1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27N5O4/c1-9(27-17(25)18(2,3)4)26-7-10-5-12(24)13(23-10)11-6-20-15-14(11)21-8-22-16(15)19/h6,8-10,12-13,20,23-24H,5,7H2,1-4H3,(H2,19,21,22) |
| InChIKey | AFUUQGMUGAMRME-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|