C16H25N3O2 — CID 123479226
5-[4-(penta-1,3-dien-2-yloxymethyl)piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 123479226) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-[4-(penta-1,3-dien-2-yloxymethyl)piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[4-(penta-1,3-dien-2-yloxymethyl)piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123479226 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 5-[4-(penta-1,3-dien-2-yloxymethyl)piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | C=C(C=CC)OCC1CCN(c2nc(C(C)C)no2)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-6-13(4)20-11-14-7-9-19(10-8-14)16-17-15(12(2)3)18-21-16/h5-6,12,14H,4,7-11H2,1-3H3 |
| InChIKey | GMQFWCSJJZWNPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|