C16H23N5O2 — CID 123479607
N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrrol-2-yl]methyl]-1-methyl-N-propylpyrrole-2-carboxamide (PubChem CID 123479607) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrrol-2-yl]methyl]-1-methyl-N-propylpyrrole-2-carboxamide.
| Compound Name | N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrrol-2-yl]methyl]-1-methyl-N-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 123479607 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[[4-(N'-hydroxycarbamimidoyl)-1-methylpyrrol-2-yl]methyl]-1-methyl-N-propylpyrrole-2-carboxamide |
| SMILES | CCCN(Cc1cc(C(N)=NO)cn1C)C(=O)c1cccn1C |
| InChI | InChI=1S/C16H23N5O2/c1-4-7-21(16(22)14-6-5-8-19(14)2)11-13-9-12(10-20(13)3)15(17)18-23/h5-6,8-10,23H,4,7,11H2,1-3H3,(H2,17,18) |
| InChIKey | YQFHIVYIPCWPFM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|