C10H16N2O — CID 60654004
N,N-diethyl-1-methylpyrrole-2-carboxamide (PubChem CID 60654004) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N,N-diethyl-1-methylpyrrole-2-carboxamide.
| Compound Name | N,N-diethyl-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60654004 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N,N-diethyl-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccn1C |
| InChI | InChI=1S/C10H16N2O/c1-4-12(5-2)10(13)9-7-6-8-11(9)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | MUAYMWCRNRTGKR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |