C9H11ClN2O2 — CID 28893231
N-(2-chloroacetyl)-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 28893231) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is N-(2-chloroacetyl)-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-chloroacetyl)-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 28893231 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | N-(2-chloroacetyl)-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CN(C(=O)CCl)C(=O)c1cccn1C |
| InChI | InChI=1S/C9H11ClN2O2/c1-11-5-3-4-7(11)9(14)12(2)8(13)6-10/h3-5H,6H2,1-2H3 |
| InChIKey | ZVJPTMLJYDVYQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|