C10H4Cl2FNO2 — CID 123482569
4-chloro-5-(4-chloro-3-fluorophenyl)-1,2-oxazole-3-carbaldehyde (PubChem CID 123482569) has the molecular formula C10H4Cl2FNO2 and a molecular weight of 260.05 g/mol. Its IUPAC name is 4-chloro-5-(4-chloro-3-fluorophenyl)-1,2-oxazole-3-carbaldehyde.
| Compound Name | 4-chloro-5-(4-chloro-3-fluorophenyl)-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 123482569 |
| Molecular Formula | C10H4Cl2FNO2 |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 4-chloro-5-(4-chloro-3-fluorophenyl)-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1noc(-c2ccc(Cl)c(F)c2)c1Cl |
| InChI | InChI=1S/C10H4Cl2FNO2/c11-6-2-1-5(3-7(6)13)10-9(12)8(4-15)14-16-10/h1-4H |
| InChIKey | PFDCASPXBAILKD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|