C23H32F3NO4 — CID 123485568
(5R,6R)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[4-(trifluoromethyl)phenyl]non-7-enoic acid (PubChem CID 123485568) has the molecular formula C23H32F3NO4 and a molecular weight of 443.51 g/mol. Its IUPAC name is (5R,6R)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[4-(trifluoromethyl)phenyl]non-7-enoic acid.
| Compound Name | (5R,6R)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[4-(trifluoromethyl)phenyl]non-7-enoic acid |
|---|---|
| PubChem CID | 123485568 |
| Molecular Formula | C23H32F3NO4 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (5R,6R)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[4-(trifluoromethyl)phenyl]non-7-enoic acid |
| SMILES | CC=C[C@H](c1ccc(C(F)(F)F)cc1)[C@@H](CCC(C)(C)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32F3NO4/c1-7-8-17(15-9-11-16(12-10-15)23(24,25)26)18(13-14-22(5,6)19(28)29)27-20(30)31-21(2,3)4/h7-12,17-18H,13-14H2,1-6H3,(H,27,30)(H,28,29)/t17-,18-/m1/s1 |
| InChIKey | CGHLUIVSBJWHJR-QZTJIDSGSA-N |
| XLogP | 6.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|