C20H30F3NO3Si — CID 67089519
[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid (PubChem CID 67089519) has the molecular formula C20H30F3NO3Si and a molecular weight of 417.54 g/mol. Its IUPAC name is [(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid.
| Compound Name | [(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67089519 |
| Molecular Formula | C20H30F3NO3Si |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[4-(trifluoromethyl)phenyl]hex-4-en-2-yl]carbamic acid |
| SMILES | CC=C[C@@H](c1ccc(C(F)(F)F)cc1)[C@@H](CO[Si](C)(C)C(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C20H30F3NO3Si/c1-7-8-16(14-9-11-15(12-10-14)20(21,22)23)17(24-18(25)26)13-27-28(5,6)19(2,3)4/h7-12,16-17,24H,13H2,1-6H3,(H,25,26)/t16-,17+/m0/s1 |
| InChIKey | KUEBGPKAWKKDEO-DLBZAZTESA-N |
| XLogP | 6.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|