C34H53N5O — CID 123486129
N,N-bis(3-methylbutyl)-2-[3-(methyliminomethyl)hexa-3,5-dienyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide (PubChem CID 123486129) has the molecular formula C34H53N5O and a molecular weight of 547.83 g/mol. Its IUPAC name is N,N-bis(3-methylbutyl)-2-[3-(methyliminomethyl)hexa-3,5-dienyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide.
| Compound Name | N,N-bis(3-methylbutyl)-2-[3-(methyliminomethyl)hexa-3,5-dienyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 123486129 |
| Molecular Formula | C34H53N5O |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.43 |
| IUPAC Name | N,N-bis(3-methylbutyl)-2-[3-(methyliminomethyl)hexa-3,5-dienyl]-3-(3-piperidin-1-ylpropyl)benzimidazole-5-carboxamide |
| SMILES | C=CC=C(/C=N/C)CCc1nc2ccc(C(=O)N(CCC(C)C)CCC(C)C)cc2n1CCCN1CCCCC1 |
| InChI | InChI=1S/C34H53N5O/c1-7-12-29(26-35-6)13-16-33-36-31-15-14-30(34(40)38(23-17-27(2)3)24-18-28(4)5)25-32(31)39(33)22-11-21-37-19-9-8-10-20-37/h7,12,14-15,25-28H,1,8-11,13,16-24H2,2-6H3/b29-12?,35-26+ |
| InChIKey | BUCQPXWTBFUILF-QLVIOSBYSA-N |
| XLogP | 7.19 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|