C30H48N4O3 — CID 58770915
methyl 5-[6-[bis(2-methylpropyl)carbamoyl]-1-(3-piperidin-1-ylpropyl)benzimidazol-2-yl]pentanoate (PubChem CID 58770915) has the molecular formula C30H48N4O3 and a molecular weight of 512.74 g/mol. Its IUPAC name is methyl 5-[6-[bis(2-methylpropyl)carbamoyl]-1-(3-piperidin-1-ylpropyl)benzimidazol-2-yl]pentanoate.
| Compound Name | methyl 5-[6-[bis(2-methylpropyl)carbamoyl]-1-(3-piperidin-1-ylpropyl)benzimidazol-2-yl]pentanoate |
|---|---|
| PubChem CID | 58770915 |
| Molecular Formula | C30H48N4O3 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | methyl 5-[6-[bis(2-methylpropyl)carbamoyl]-1-(3-piperidin-1-ylpropyl)benzimidazol-2-yl]pentanoate |
| SMILES | COC(=O)CCCCc1nc2ccc(C(=O)N(CC(C)C)CC(C)C)cc2n1CCCN1CCCCC1 |
| InChI | InChI=1S/C30H48N4O3/c1-23(2)21-33(22-24(3)4)30(36)25-14-15-26-27(20-25)34(19-11-18-32-16-9-6-10-17-32)28(31-26)12-7-8-13-29(35)37-5/h14-15,20,23-24H,6-13,16-19,21-22H2,1-5H3 |
| InChIKey | FQGWQZJXPISWBA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|