About 1-amino-8-butyldodeca-7,11-dien-6-one
1-amino-8-butyldodeca-7,11-dien-6-one (PubChem CID 123487702) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-amino-8-butyldodeca-7,11-dien-6-one.
Molecular Properties
| Compound Name | 1-amino-8-butyldodeca-7,11-dien-6-one |
| PubChem CID | 123487702 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-amino-8-butyldodeca-7,11-dien-6-one |
| SMILES | C=CCCC(=CC(=O)CCCCCN)CCCC |
| InChI | InChI=1S/C16H29NO/c1-3-5-10-15(11-6-4-2)14-16(18)12-8-7-9-13-17/h3,14H,1,4-13,17H2,2H3 |
| InChIKey | JWGJMORJWKVITK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-8-butyldodeca-7,11-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-8-butyldodeca-7,11-dien-6-one?
The IUPAC name of 1-amino-8-butyldodeca-7,11-dien-6-one (CID 123487702) is 1-amino-8-butyldodeca-7,11-dien-6-one.
What is the SMILES notation for 1-amino-8-butyldodeca-7,11-dien-6-one?
The canonical SMILES for 1-amino-8-butyldodeca-7,11-dien-6-one is C=CCCC(=CC(=O)CCCCCN)CCCC.
What is the InChIKey of 1-amino-8-butyldodeca-7,11-dien-6-one?
The InChIKey is JWGJMORJWKVITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO/c1-3-5-10-15(11-6-4-2)14-16(18)12-8-7-9-13-17/h3,14H,1,4-13,17H2,2H3.
What are the key properties of 1-amino-8-butyldodeca-7,11-dien-6-one?
1-amino-8-butyldodeca-7,11-dien-6-one has a molecular weight of 251.41 g/mol, XLogP of 4.16, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-8-butyldodeca-7,11-dien-6-one is sourced from PubChem (CID 123487702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).