C11H17NO — CID 123488429
6-butan-2-yl-1,4-dimethylpyridin-2-one (PubChem CID 123488429) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 6-butan-2-yl-1,4-dimethylpyridin-2-one.
| Compound Name | 6-butan-2-yl-1,4-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 123488429 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 6-butan-2-yl-1,4-dimethylpyridin-2-one |
| SMILES | CCC(C)c1cc(C)cc(=O)n1C |
| InChI | InChI=1S/C11H17NO/c1-5-9(3)10-6-8(2)7-11(13)12(10)4/h6-7,9H,5H2,1-4H3 |
| InChIKey | QVVRLCNMHWCVMS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |