C13H22O3 — CID 123490995
ethyl 4-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]pent-4-enoate (PubChem CID 123490995) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethyl 4-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]pent-4-enoate.
| Compound Name | ethyl 4-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]pent-4-enoate |
|---|---|
| PubChem CID | 123490995 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethyl 4-methyl-3-methylidene-2-[(2-methylpropan-2-yl)oxy]pent-4-enoate |
| SMILES | C=C(C)C(=C)C(OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C13H22O3/c1-8-15-12(14)11(10(4)9(2)3)16-13(5,6)7/h11H,2,4,8H2,1,3,5-7H3 |
| InChIKey | ZOAPGROJZGWYIS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|