C17H26Si — CID 123492298
(2-tert-butylcyclopenta-1,3-dien-1-yl)-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123492298) has the molecular formula C17H26Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123492298 |
| Molecular Formula | C17H26Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2-tert-butylcyclopenta-1,3-dien-1-yl)-(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)=C([SiH2]C2=C(C(C)(C)C)C=CC2)C1 |
| InChI | InChI=1S/C17H26Si/c1-11-10-16(13(3)12(11)2)18-15-9-7-8-14(15)17(4,5)6/h7-8H,9-10,18H2,1-6H3 |
| InChIKey | JDLUFZDNOTZJAV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|