C20H40N7O3+ — CID 123493456
3,3-diamino-2-[5-(cyanomethyl)-1-ethyl-1-methyl-1,3-diazinan-1-ium-2-yl]-N-[4-(3-hydroxypropoxy)piperidin-3-yl]propanamide (PubChem CID 123493456) has the molecular formula C20H40N7O3+ and a molecular weight of 426.59 g/mol. Its IUPAC name is 3,3-diamino-2-[5-(cyanomethyl)-1-ethyl-1-methyl-1,3-diazinan-1-ium-2-yl]-N-[4-(3-hydroxypropoxy)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[5-(cyanomethyl)-1-ethyl-1-methyl-1,3-diazinan-1-ium-2-yl]-N-[4-(3-hydroxypropoxy)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123493456 |
| Molecular Formula | C20H40N7O3+ |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 3,3-diamino-2-[5-(cyanomethyl)-1-ethyl-1-methyl-1,3-diazinan-1-ium-2-yl]-N-[4-(3-hydroxypropoxy)piperidin-3-yl]propanamide |
| SMILES | CC[N+]1(C)CC(CC#N)CNC1C(C(=O)NC1CNCCC1OCCCO)C(N)N |
| InChI | InChI=1S/C20H39N7O3/c1-3-27(2)13-14(5-7-21)11-25-19(27)17(18(22)23)20(29)26-15-12-24-8-6-16(15)30-10-4-9-28/h14-19,24-25,28H,3-6,8-13,22-23H2,1-2H3/p+1 |
| InChIKey | ZDBHJJDTJKHMAL-UHFFFAOYSA-O |
| XLogP | -1.98 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|