C19H35N7O2 — CID 123209092
3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-cyclopentyloxypiperidin-3-yl)propanamide (PubChem CID 123209092) has the molecular formula C19H35N7O2 and a molecular weight of 393.54 g/mol. Its IUPAC name is 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-cyclopentyloxypiperidin-3-yl)propanamide.
| Compound Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-cyclopentyloxypiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 123209092 |
| Molecular Formula | C19H35N7O2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-(4-cyclopentyloxypiperidin-3-yl)propanamide |
| SMILES | N#CCC1CNC(C(C(=O)NC2CNCCC2OC2CCCC2)C(N)N)NC1 |
| InChI | InChI=1S/C19H35N7O2/c20-7-5-12-9-24-18(25-10-12)16(17(21)22)19(27)26-14-11-23-8-6-15(14)28-13-3-1-2-4-13/h12-18,23-25H,1-6,8-11,21-22H2,(H,26,27) |
| InChIKey | PTLHWOBUQLWOFJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|