C23H45N8O2+ — CID 163736392
3,3-diamino-2-[4-(cyanomethyl)-2-aza-6-azoniaspiro[5.5]undecan-1-yl]-N-[4-[2-(dimethylamino)ethoxy]piperidin-3-yl]propanamide (PubChem CID 163736392) has the molecular formula C23H45N8O2+ and a molecular weight of 465.67 g/mol. Its IUPAC name is 3,3-diamino-2-[4-(cyanomethyl)-2-aza-6-azoniaspiro[5.5]undecan-1-yl]-N-[4-[2-(dimethylamino)ethoxy]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-[4-(cyanomethyl)-2-aza-6-azoniaspiro[5.5]undecan-1-yl]-N-[4-[2-(dimethylamino)ethoxy]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 163736392 |
| Molecular Formula | C23H45N8O2+ |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.37 |
| IUPAC Name | 3,3-diamino-2-[4-(cyanomethyl)-2-aza-6-azoniaspiro[5.5]undecan-1-yl]-N-[4-[2-(dimethylamino)ethoxy]piperidin-3-yl]propanamide |
| SMILES | CN(C)CCOC1CCNCC1NC(=O)C(C(N)N)C1NCC(CC#N)C[N+]12CCCCC2 |
| InChI | InChI=1S/C23H44N8O2/c1-30(2)10-13-33-19-7-9-27-15-18(19)29-23(32)20(21(25)26)22-28-14-17(6-8-24)16-31(22)11-4-3-5-12-31/h17-22,27-28H,3-7,9-16,25-26H2,1-2H3/p+1 |
| InChIKey | LDYVUIUGGCOTMI-UHFFFAOYSA-O |
| XLogP | -1.27 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|