C36H82O3Si4 — CID 123493770
dimethyl-[1,1,2-triethyl-2-[methyl-octyl-(2-trimethylsilylbutan-2-yloxy)silyl]butoxy]-(3-trimethylsilyloxypentan-3-yl)silane (PubChem CID 123493770) has the molecular formula C36H82O3Si4 and a molecular weight of 675.39 g/mol. Its IUPAC name is dimethyl-[1,1,2-triethyl-2-[methyl-octyl-(2-trimethylsilylbutan-2-yloxy)silyl]butoxy]-(3-trimethylsilyloxypentan-3-yl)silane.
| Compound Name | dimethyl-[1,1,2-triethyl-2-[methyl-octyl-(2-trimethylsilylbutan-2-yloxy)silyl]butoxy]-(3-trimethylsilyloxypentan-3-yl)silane |
|---|---|
| PubChem CID | 123493770 |
| Molecular Formula | C36H82O3Si4 |
| Molecular Weight | 675.39 g/mol |
| Exact Mass | 674.53 |
| IUPAC Name | dimethyl-[1,1,2-triethyl-2-[methyl-octyl-(2-trimethylsilylbutan-2-yloxy)silyl]butoxy]-(3-trimethylsilyloxypentan-3-yl)silane |
| SMILES | CCCCCCCC[Si](C)(OC(C)(CC)[Si](C)(C)C)C(CC)(CC)C(CC)(CC)O[Si](C)(C)C(CC)(CC)O[Si](C)(C)C |
| InChI | InChI=1S/C36H82O3Si4/c1-19-27-28-29-30-31-32-43(18,37-33(9,20-2)40(10,11)12)35(23-5,24-6)34(21-3,22-4)38-42(16,17)36(25-7,26-8)39-41(13,14)15/h19-32H2,1-18H3 |
| InChIKey | BPPBUBQXSWWGPV-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.39 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|