C8H20N4S — CID 123494037
N-[[[dimethylamino(ethylsulfanyl)methyl]amino]methyl]-N'-methylmethanimidamide (PubChem CID 123494037) has the molecular formula C8H20N4S and a molecular weight of 204.34 g/mol. Its IUPAC name is N-[[[dimethylamino(ethylsulfanyl)methyl]amino]methyl]-N'-methylmethanimidamide.
| Compound Name | N-[[[dimethylamino(ethylsulfanyl)methyl]amino]methyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 123494037 |
| Molecular Formula | C8H20N4S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-[[[dimethylamino(ethylsulfanyl)methyl]amino]methyl]-N'-methylmethanimidamide |
| SMILES | CCSC(NCN/C=N/C)N(C)C |
| InChI | InChI=1S/C8H20N4S/c1-5-13-8(12(3)4)11-7-10-6-9-2/h6,8,11H,5,7H2,1-4H3,(H,9,10) |
| InChIKey | FTOPPMWFXMKQAS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|