About N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide
N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide (PubChem CID 142202873) has the molecular formula C7H18N4
and a molecular weight of 158.25 g/mol. Its IUPAC name is N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide |
| PubChem CID | 142202873 |
| Molecular Formula | C7H18N4 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide |
| SMILES | C/N=C/NC(CNC)N(C)C |
| InChI | InChI=1S/C7H18N4/c1-8-5-7(11(3)4)10-6-9-2/h6-8H,5H2,1-4H3,(H,9,10) |
| InChIKey | OEJVVLMVWUGZJD-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide?
The IUPAC name of N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide (CID 142202873) is N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide?
The canonical SMILES for N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide is C/N=C/NC(CNC)N(C)C.
What is the InChIKey of N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide?
The InChIKey is OEJVVLMVWUGZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N4/c1-8-5-7(11(3)4)10-6-9-2/h6-8H,5H2,1-4H3,(H,9,10).
What are the key properties of N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide?
N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide has a molecular weight of 158.25 g/mol, XLogP of -0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(dimethylamino)-2-(methylamino)ethyl]-N'-methylmethanimidamide is sourced from PubChem (CID 142202873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).