About N-(1-iodoethyl)-N'-methylmethanimidamide
N-(1-iodoethyl)-N'-methylmethanimidamide (PubChem CID 163628896) has the molecular formula C4H9IN2
and a molecular weight of 212.03 g/mol. Its IUPAC name is N-(1-iodoethyl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(1-iodoethyl)-N'-methylmethanimidamide |
| PubChem CID | 163628896 |
| Molecular Formula | C4H9IN2 |
| Molecular Weight | 212.03 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | N-(1-iodoethyl)-N'-methylmethanimidamide |
| SMILES | C/N=C/NC(C)I |
| InChI | InChI=1S/C4H9IN2/c1-4(5)7-3-6-2/h3-4H,1-2H3,(H,6,7) |
| InChIKey | HUJNCNYKCDFVFP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-iodoethyl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-iodoethyl)-N'-methylmethanimidamide?
The IUPAC name of N-(1-iodoethyl)-N'-methylmethanimidamide (CID 163628896) is N-(1-iodoethyl)-N'-methylmethanimidamide.
What is the SMILES notation for N-(1-iodoethyl)-N'-methylmethanimidamide?
The canonical SMILES for N-(1-iodoethyl)-N'-methylmethanimidamide is C/N=C/NC(C)I.
What is the InChIKey of N-(1-iodoethyl)-N'-methylmethanimidamide?
The InChIKey is HUJNCNYKCDFVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9IN2/c1-4(5)7-3-6-2/h3-4H,1-2H3,(H,6,7).
What are the key properties of N-(1-iodoethyl)-N'-methylmethanimidamide?
N-(1-iodoethyl)-N'-methylmethanimidamide has a molecular weight of 212.03 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-iodoethyl)-N'-methylmethanimidamide is sourced from PubChem (CID 163628896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).