C29H35F2NO4 — CID 123494400
17-[[benzyl(methyl)amino]methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 123494400) has the molecular formula C29H35F2NO4 and a molecular weight of 499.60 g/mol. Its IUPAC name is 17-[[benzyl(methyl)amino]methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 17-[[benzyl(methyl)amino]methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 123494400 |
| Molecular Formula | C29H35F2NO4 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 17-[[benzyl(methyl)amino]methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CN(Cc1ccccc1)CC1(C(=O)O)CCC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C29H35F2NO4/c1-26-11-9-19(33)13-22(26)23(30)14-21-20-10-12-28(25(35)36,27(20,2)15-24(34)29(21,26)31)17-32(3)16-18-7-5-4-6-8-18/h4-9,11,13,20-21,23-24,34H,10,12,14-17H2,1-3H3,(H,35,36) |
| InChIKey | UNYCVEIFOSPCBJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |