C22H18FN3O3S — CID 123496545
4-[2-[5-(1,3-dioxolan-2-yl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxy-2-fluoro-3-methylaniline (PubChem CID 123496545) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-[2-[5-(1,3-dioxolan-2-yl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxy-2-fluoro-3-methylaniline.
| Compound Name | 4-[2-[5-(1,3-dioxolan-2-yl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxy-2-fluoro-3-methylaniline |
|---|---|
| PubChem CID | 123496545 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-[2-[5-(1,3-dioxolan-2-yl)-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxy-2-fluoro-3-methylaniline |
| SMILES | Cc1c(Oc2ccnc3cc(-c4ccc(C5OCCO5)cn4)sc23)ccc(N)c1F |
| InChI | InChI=1S/C22H18FN3O3S/c1-12-17(5-3-14(24)20(12)23)29-18-6-7-25-16-10-19(30-21(16)18)15-4-2-13(11-26-15)22-27-8-9-28-22/h2-7,10-11,22H,8-9,24H2,1H3 |
| InChIKey | YHWDUPFWGZBXOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|