methyl 2-methylbut-3-yn-2-yl hydrogen phosphate

C6H11O4P — CID 123497642

IUPACmethyl 2-methylbut-3-yn-2-yl hydrogen phosphate
SMILESC#CC(C)(C)OP(=O)(O)OC
InChIInChI=1S/C6H11O4P/c1-5-6(2,3)10-11(7,8)9-4/h1H,2-4H3,(H,7,8)
InChIKeyUGCPDPCDQLLMRK-UHFFFAOYSA-N
MW178.12 g/mol
LogP1.16
Rot. Bonds3

About methyl 2-methylbut-3-yn-2-yl hydrogen phosphate

methyl 2-methylbut-3-yn-2-yl hydrogen phosphate (PubChem CID 123497642) has the molecular formula C6H11O4P and a molecular weight of 178.12 g/mol. Its IUPAC name is methyl 2-methylbut-3-yn-2-yl hydrogen phosphate.

Molecular Properties

Compound Namemethyl 2-methylbut-3-yn-2-yl hydrogen phosphate
PubChem CID123497642
Molecular FormulaC6H11O4P
Molecular Weight178.12 g/mol
Exact Mass178.04
IUPAC Namemethyl 2-methylbut-3-yn-2-yl hydrogen phosphate
SMILESC#CC(C)(C)OP(=O)(O)OC
InChIInChI=1S/C6H11O4P/c1-5-6(2,3)10-11(7,8)9-4/h1H,2-4H3,(H,7,8)
InChIKeyUGCPDPCDQLLMRK-UHFFFAOYSA-N
XLogP1.16
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.12
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl 2-methylbut-3-yn-2-yl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylbut-3-yn-2-yl hydrogen phosphate?
The IUPAC name of methyl 2-methylbut-3-yn-2-yl hydrogen phosphate (CID 123497642) is methyl 2-methylbut-3-yn-2-yl hydrogen phosphate.
What is the SMILES notation for methyl 2-methylbut-3-yn-2-yl hydrogen phosphate?
The canonical SMILES for methyl 2-methylbut-3-yn-2-yl hydrogen phosphate is C#CC(C)(C)OP(=O)(O)OC.
What is the InChIKey of methyl 2-methylbut-3-yn-2-yl hydrogen phosphate?
The InChIKey is UGCPDPCDQLLMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O4P/c1-5-6(2,3)10-11(7,8)9-4/h1H,2-4H3,(H,7,8).
What are the key properties of methyl 2-methylbut-3-yn-2-yl hydrogen phosphate?
methyl 2-methylbut-3-yn-2-yl hydrogen phosphate has a molecular weight of 178.12 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylbut-3-yn-2-yl hydrogen phosphate is sourced from PubChem (CID 123497642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).