C10H9NO — CID 123499415
5-methyl-1,3-dihydrocyclohepta[b]pyrrol-2-one (PubChem CID 123499415) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-methyl-1,3-dihydrocyclohepta[b]pyrrol-2-one.
| Compound Name | 5-methyl-1,3-dihydrocyclohepta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 123499415 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-methyl-1,3-dihydrocyclohepta[b]pyrrol-2-one |
| SMILES | CC1=CC2=C(C=C=C1)NC(=O)C2 |
| InChI | InChI=1S/C10H9NO/c1-7-3-2-4-9-8(5-7)6-10(12)11-9/h3-5H,6H2,1H3,(H,11,12) |
| InChIKey | NFDCJGFXXJRPHY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |