C10H15NO — CID 18707393
N-cyclohexa-1,5-dien-1-ylbutanamide (PubChem CID 18707393) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-ylbutanamide.
| Compound Name | N-cyclohexa-1,5-dien-1-ylbutanamide |
|---|---|
| PubChem CID | 18707393 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-ylbutanamide |
| SMILES | CCCC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C10H15NO/c1-2-6-10(12)11-9-7-4-3-5-8-9/h4,7-8H,2-3,5-6H2,1H3,(H,11,12) |
| InChIKey | INHCIUUVJOQQBO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |