C8H9F2NO — CID 142113001
N-(2,4-difluorocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 142113001) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is N-(2,4-difluorocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-(2,4-difluorocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 142113001 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | N-(2,4-difluorocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=C(F)CC(F)C=C1 |
| InChI | InChI=1S/C8H9F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-3,6H,4H2,1H3,(H,11,12) |
| InChIKey | XYZBYAZFYOKSLR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |