C9H9F2NO — CID 142035875
N-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)acetamide (PubChem CID 142035875) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is N-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)acetamide.
| Compound Name | N-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)acetamide |
|---|---|
| PubChem CID | 142035875 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | N-(2,5-difluorocyclohepta-1,4,6-trien-1-yl)acetamide |
| SMILES | CC(=O)NC1=C(F)CC=C(F)C=C1 |
| InChI | InChI=1S/C9H9F2NO/c1-6(13)12-9-5-3-7(10)2-4-8(9)11/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | RNLPPHRQCPHEKL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |