C8H10FNO — CID 143299281
N-(4-fluorocyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 143299281) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is N-(4-fluorocyclohexa-1,3-dien-1-yl)acetamide.
| Compound Name | N-(4-fluorocyclohexa-1,3-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 143299281 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(4-fluorocyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC=C(F)CC1 |
| InChI | InChI=1S/C8H10FNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2,4H,3,5H2,1H3,(H,10,11) |
| InChIKey | MRTNMUPMTRPMFD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |