C19H18F3N3O2 — CID 123502475
2-imino-4-[1-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethylideneamino]pentan-3-one (PubChem CID 123502475) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-imino-4-[1-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethylideneamino]pentan-3-one.
| Compound Name | 2-imino-4-[1-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethylideneamino]pentan-3-one |
|---|---|
| PubChem CID | 123502475 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-imino-4-[1-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethylideneamino]pentan-3-one |
| SMILES | [H]/N=C(\C)C(=O)C(C)/N=C(\C)c1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-11(23)18(26)13(3)25-12(2)14-4-7-16(8-5-14)27-17-9-6-15(10-24-17)19(20,21)22/h4-10,13,23H,1-3H3/b23-11+,25-12+ |
| InChIKey | PVSKIHHKYGEMRJ-YRTOTOJMSA-N |
| XLogP | 4.70 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|