C16H25NO2 — CID 123502903
1-(2-cyclononylpropyl)pyrrole-2,5-dione (PubChem CID 123502903) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-(2-cyclononylpropyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-cyclononylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123502903 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-(2-cyclononylpropyl)pyrrole-2,5-dione |
| SMILES | CC(CN1C(=O)C=CC1=O)C1CCCCCCCC1 |
| InChI | InChI=1S/C16H25NO2/c1-13(12-17-15(18)10-11-16(17)19)14-8-6-4-2-3-5-7-9-14/h10-11,13-14H,2-9,12H2,1H3 |
| InChIKey | ABNOEFBNMHTLDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|