C16H20N2O4 — CID 157383581
1-cyclohexylpyrrole-2,5-dione;1-ethylpyrrole-2,5-dione (PubChem CID 157383581) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-cyclohexylpyrrole-2,5-dione;1-ethylpyrrole-2,5-dione.
| Compound Name | 1-cyclohexylpyrrole-2,5-dione;1-ethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 157383581 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-cyclohexylpyrrole-2,5-dione;1-ethylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)C=CC1=O.O=C1C=CC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C10H13NO2.C6H7NO2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-7-5(8)3-4-6(7)9/h6-8H,1-5H2;3-4H,2H2,1H3 |
| InChIKey | BLDZPVVEDKRFJT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|