C15H16N2O4 — CID 159672189
1-cyclobutylpyrrole-2,5-dione;1-cyclopropylpyrrole-2,5-dione (PubChem CID 159672189) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-cyclobutylpyrrole-2,5-dione;1-cyclopropylpyrrole-2,5-dione.
| Compound Name | 1-cyclobutylpyrrole-2,5-dione;1-cyclopropylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 159672189 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-cyclobutylpyrrole-2,5-dione;1-cyclopropylpyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1CC1.O=C1C=CC(=O)N1C1CCC1 |
| InChI | InChI=1S/C8H9NO2.C7H7NO2/c10-7-4-5-8(11)9(7)6-2-1-3-6;9-6-3-4-7(10)8(6)5-1-2-5/h4-6H,1-3H2;3-5H,1-2H2 |
| InChIKey | MUDGEAWZHGVAKF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|