C11H14N2O4 — CID 18439097
1-cyclopentylpyrrole-2,5-dione;2-methyloxaziridin-3-one (PubChem CID 18439097) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-cyclopentylpyrrole-2,5-dione;2-methyloxaziridin-3-one.
| Compound Name | 1-cyclopentylpyrrole-2,5-dione;2-methyloxaziridin-3-one |
|---|---|
| PubChem CID | 18439097 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-cyclopentylpyrrole-2,5-dione;2-methyloxaziridin-3-one |
| SMILES | CN1OC1=O.O=C1C=CC(=O)N1C1CCCC1 |
| InChI | InChI=1S/C9H11NO2.C2H3NO2/c11-8-5-6-9(12)10(8)7-3-1-2-4-7;1-3-2(4)5-3/h5-7H,1-4H2;1H3 |
| InChIKey | GFTYPAUSZIBNPM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|