About 1-ethylpyrrole-2,5-dione;methanediimine
1-ethylpyrrole-2,5-dione;methanediimine (PubChem CID 175097236) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 1-ethylpyrrole-2,5-dione;methanediimine.
Molecular Properties
| Compound Name | 1-ethylpyrrole-2,5-dione;methanediimine |
| PubChem CID | 175097236 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 1-ethylpyrrole-2,5-dione;methanediimine |
| SMILES | CCN1C(=O)C=CC1=O.N=C=N |
| InChI | InChI=1S/C6H7NO2.CH2N2/c1-2-7-5(8)3-4-6(7)9;2-1-3/h3-4H,2H2,1H3;2-3H |
| InChIKey | QDCSCIZLJWAYGY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyrrole-2,5-dione;methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrole-2,5-dione;methanediimine?
The IUPAC name of 1-ethylpyrrole-2,5-dione;methanediimine (CID 175097236) is 1-ethylpyrrole-2,5-dione;methanediimine.
What is the SMILES notation for 1-ethylpyrrole-2,5-dione;methanediimine?
The canonical SMILES for 1-ethylpyrrole-2,5-dione;methanediimine is CCN1C(=O)C=CC1=O.N=C=N.
What is the InChIKey of 1-ethylpyrrole-2,5-dione;methanediimine?
The InChIKey is QDCSCIZLJWAYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.CH2N2/c1-2-7-5(8)3-4-6(7)9;2-1-3/h3-4H,2H2,1H3;2-3H.
What are the key properties of 1-ethylpyrrole-2,5-dione;methanediimine?
1-ethylpyrrole-2,5-dione;methanediimine has a molecular weight of 167.17 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrole-2,5-dione;methanediimine is sourced from PubChem (CID 175097236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).