C28H41N3OSi — CID 123503604
12-azidododec-7-enoxy-tert-butyl-diphenylsilane (PubChem CID 123503604) has the molecular formula C28H41N3OSi and a molecular weight of 463.74 g/mol. Its IUPAC name is 12-azidododec-7-enoxy-tert-butyl-diphenylsilane.
| Compound Name | 12-azidododec-7-enoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 123503604 |
| Molecular Formula | C28H41N3OSi |
| Molecular Weight | 463.74 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | 12-azidododec-7-enoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCCCC=CCCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41N3OSi/c1-28(2,3)33(26-20-14-12-15-21-26,27-22-16-13-17-23-27)32-25-19-11-9-7-5-4-6-8-10-18-24-30-31-29/h4,6,12-17,20-23H,5,7-11,18-19,24-25H2,1-3H3 |
| InChIKey | BLUZDWIMLMBJQY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.74 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|