C11H21N — CID 123504058
2-ethyl-N,4-dimethyl-3-methylidenehex-4-en-1-amine (PubChem CID 123504058) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-ethyl-N,4-dimethyl-3-methylidenehex-4-en-1-amine.
| Compound Name | 2-ethyl-N,4-dimethyl-3-methylidenehex-4-en-1-amine |
|---|---|
| PubChem CID | 123504058 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-ethyl-N,4-dimethyl-3-methylidenehex-4-en-1-amine |
| SMILES | C=C(C(C)=CC)C(CC)CNC |
| InChI | InChI=1S/C11H21N/c1-6-9(3)10(4)11(7-2)8-12-5/h6,11-12H,4,7-8H2,1-3,5H3 |
| InChIKey | BCFAWLPKHZGTNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|