C8H9Cl3O2 — CID 123504333
2,4,5-trichlorohexa-2,4-dien-3-yl acetate (PubChem CID 123504333) has the molecular formula C8H9Cl3O2 and a molecular weight of 243.52 g/mol. Its IUPAC name is 2,4,5-trichlorohexa-2,4-dien-3-yl acetate.
| Compound Name | 2,4,5-trichlorohexa-2,4-dien-3-yl acetate |
|---|---|
| PubChem CID | 123504333 |
| Molecular Formula | C8H9Cl3O2 |
| Molecular Weight | 243.52 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 2,4,5-trichlorohexa-2,4-dien-3-yl acetate |
| SMILES | CC(=O)OC(=C(C)Cl)C(Cl)=C(C)Cl |
| InChI | InChI=1S/C8H9Cl3O2/c1-4(9)7(11)8(5(2)10)13-6(3)12/h1-3H3 |
| InChIKey | UUFJXLNNVRZSFS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|