C31H37ClN2O3 — CID 123505528
tert-butyl (3S,4S)-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-pyridin-3-ylpiperidine-1-carboxylate (PubChem CID 123505528) has the molecular formula C31H37ClN2O3 and a molecular weight of 521.10 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-pyridin-3-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-pyridin-3-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123505528 |
| Molecular Formula | C31H37ClN2O3 |
| Molecular Weight | 521.10 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | tert-butyl (3S,4S)-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-pyridin-3-ylpiperidine-1-carboxylate |
| SMILES | COCCCc1ccccc1-c1ccc([C@H]2CN(C(=O)OC(C)(C)C)CC[C@@H]2c2cccnc2)c(Cl)c1 |
| InChI | InChI=1S/C31H37ClN2O3/c1-31(2,3)37-30(35)34-17-15-26(24-10-7-16-33-20-24)28(21-34)27-14-13-23(19-29(27)32)25-12-6-5-9-22(25)11-8-18-36-4/h5-7,9-10,12-14,16,19-20,26,28H,8,11,15,17-18,21H2,1-4H3/t26-,28+/m1/s1 |
| InChIKey | CCVUVNNZZVSLCY-IAPPQJPRSA-N |
| XLogP | 7.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.10 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|