C7H13NO6S — CID 123505822
O-[(2S,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] carbamothioate (PubChem CID 123505822) has the molecular formula C7H13NO6S and a molecular weight of 239.25 g/mol. Its IUPAC name is O-[(2S,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] carbamothioate.
| Compound Name | O-[(2S,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] carbamothioate |
|---|---|
| PubChem CID | 123505822 |
| Molecular Formula | C7H13NO6S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | O-[(2S,3R,4R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl] carbamothioate |
| SMILES | NC(=S)O[C@@H]1O[C@@H]([C@H](O)CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13NO6S/c8-7(15)14-6-4(12)3(11)5(13-6)2(10)1-9/h2-6,9-12H,1H2,(H2,8,15)/t2-,3-,4-,5+,6+/m1/s1 |
| InChIKey | ZKBQOGZYLDTRTA-TVIMKVIFSA-N |
| XLogP | -2.95 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|