C16H31F3O2Si2 — CID 123506086
dimethyl-[2-[[2-(3,3,3-trifluoropropylsilyl)oxan-2-yl]methyl]oxan-2-yl]silane (PubChem CID 123506086) has the molecular formula C16H31F3O2Si2 and a molecular weight of 368.59 g/mol. Its IUPAC name is dimethyl-[2-[[2-(3,3,3-trifluoropropylsilyl)oxan-2-yl]methyl]oxan-2-yl]silane.
| Compound Name | dimethyl-[2-[[2-(3,3,3-trifluoropropylsilyl)oxan-2-yl]methyl]oxan-2-yl]silane |
|---|---|
| PubChem CID | 123506086 |
| Molecular Formula | C16H31F3O2Si2 |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | dimethyl-[2-[[2-(3,3,3-trifluoropropylsilyl)oxan-2-yl]methyl]oxan-2-yl]silane |
| SMILES | C[SiH](C)C1(CC2([SiH2]CCC(F)(F)F)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C16H31F3O2Si2/c1-23(2)15(8-4-6-11-21-15)13-14(7-3-5-10-20-14)22-12-9-16(17,18)19/h23H,3-13,22H2,1-2H3 |
| InChIKey | KHIBKWWGNYBURM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|