C26H35F3O2Si2 — CID 173177427
[2-(2-diphenylsilyloxan-2-yl)oxan-2-yl]-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 173177427) has the molecular formula C26H35F3O2Si2 and a molecular weight of 492.73 g/mol. Its IUPAC name is [2-(2-diphenylsilyloxan-2-yl)oxan-2-yl]-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | [2-(2-diphenylsilyloxan-2-yl)oxan-2-yl]-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 173177427 |
| Molecular Formula | C26H35F3O2Si2 |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [2-(2-diphenylsilyloxan-2-yl)oxan-2-yl]-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[SiH](CCC(F)(F)F)C1(C2([SiH](c3ccccc3)c3ccccc3)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C26H35F3O2Si2/c1-32(21-18-26(27,28)29)24(16-8-10-19-30-24)25(17-9-11-20-31-25)33(22-12-4-2-5-13-22)23-14-6-3-7-15-23/h2-7,12-15,32-33H,8-11,16-21H2,1H3 |
| InChIKey | GTVPJSDRILIKCB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|