C23H45F3O2Si2 — CID 173269411
methyl-[2-[2-[methyl(octyl)silyl]oxan-2-yl]oxan-2-yl]-(3,3,3-trifluoropropyl)silane (PubChem CID 173269411) has the molecular formula C23H45F3O2Si2 and a molecular weight of 466.78 g/mol. Its IUPAC name is methyl-[2-[2-[methyl(octyl)silyl]oxan-2-yl]oxan-2-yl]-(3,3,3-trifluoropropyl)silane.
| Compound Name | methyl-[2-[2-[methyl(octyl)silyl]oxan-2-yl]oxan-2-yl]-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 173269411 |
| Molecular Formula | C23H45F3O2Si2 |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | methyl-[2-[2-[methyl(octyl)silyl]oxan-2-yl]oxan-2-yl]-(3,3,3-trifluoropropyl)silane |
| SMILES | CCCCCCCC[SiH](C)C1(C2([SiH](C)CCC(F)(F)F)CCCCO2)CCCCO1 |
| InChI | InChI=1S/C23H45F3O2Si2/c1-4-5-6-7-8-13-19-29(2)21(14-9-11-17-27-21)22(15-10-12-18-28-22)30(3)20-16-23(24,25)26/h29-30H,4-20H2,1-3H3 |
| InChIKey | RVUUMTWWPJCMRX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|