C9H10BrF — CID 123508174
7-(bromomethyl)-2-fluorocycloocta-1,3,5-triene (PubChem CID 123508174) has the molecular formula C9H10BrF and a molecular weight of 217.08 g/mol. Its IUPAC name is 7-(bromomethyl)-2-fluorocycloocta-1,3,5-triene.
| Compound Name | 7-(bromomethyl)-2-fluorocycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 123508174 |
| Molecular Formula | C9H10BrF |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 7-(bromomethyl)-2-fluorocycloocta-1,3,5-triene |
| SMILES | FC1=CCC(CBr)C=CC=C1 |
| InChI | InChI=1S/C9H10BrF/c10-7-8-3-1-2-4-9(11)6-5-8/h1-4,6,8H,5,7H2 |
| InChIKey | QYNYWADEOSKZCX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|