C23H26FNO2 — CID 123510633
2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hept-2-enoic acid (PubChem CID 123510633) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hept-2-enoic acid.
| Compound Name | 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hept-2-enoic acid |
|---|---|
| PubChem CID | 123510633 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[ethenyl-[1-[2-(4-fluorophenyl)phenyl]ethyl]amino]hept-2-enoic acid |
| SMILES | C=CN(C(=CCCCC)C(=O)O)C(C)c1ccccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FNO2/c1-4-6-7-12-22(23(26)27)25(5-2)17(3)20-10-8-9-11-21(20)18-13-15-19(24)16-14-18/h5,8-17H,2,4,6-7H2,1,3H3,(H,26,27) |
| InChIKey | HXNOKLXPFPOUGW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|