C25H26ClN5O2 — CID 123511565
[4-[1-(3-chlorophenyl)-1,2,4-triazole-3-carbonyl]-3-ethenyl-3-methylpiperazin-1-yl]-(4-ethylphenyl)methanone (PubChem CID 123511565) has the molecular formula C25H26ClN5O2 and a molecular weight of 463.97 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)-1,2,4-triazole-3-carbonyl]-3-ethenyl-3-methylpiperazin-1-yl]-(4-ethylphenyl)methanone.
| Compound Name | [4-[1-(3-chlorophenyl)-1,2,4-triazole-3-carbonyl]-3-ethenyl-3-methylpiperazin-1-yl]-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 123511565 |
| Molecular Formula | C25H26ClN5O2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [4-[1-(3-chlorophenyl)-1,2,4-triazole-3-carbonyl]-3-ethenyl-3-methylpiperazin-1-yl]-(4-ethylphenyl)methanone |
| SMILES | C=CC1(C)CN(C(=O)c2ccc(CC)cc2)CCN1C(=O)c1ncn(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C25H26ClN5O2/c1-4-18-9-11-19(12-10-18)23(32)29-13-14-30(25(3,5-2)16-29)24(33)22-27-17-31(28-22)21-8-6-7-20(26)15-21/h5-12,15,17H,2,4,13-14,16H2,1,3H3 |
| InChIKey | UOADBKZMQPQSLF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|