C16H28 — CID 123513312
4-[3-(2,2-dimethylcyclopropyl)but-1-en-2-yl]-1,2-dimethylcyclopentane (PubChem CID 123513312) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 4-[3-(2,2-dimethylcyclopropyl)but-1-en-2-yl]-1,2-dimethylcyclopentane.
| Compound Name | 4-[3-(2,2-dimethylcyclopropyl)but-1-en-2-yl]-1,2-dimethylcyclopentane |
|---|---|
| PubChem CID | 123513312 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 4-[3-(2,2-dimethylcyclopropyl)but-1-en-2-yl]-1,2-dimethylcyclopentane |
| SMILES | C=C(C1CC(C)C(C)C1)C(C)C1CC1(C)C |
| InChI | InChI=1S/C16H28/c1-10-7-14(8-11(10)2)12(3)13(4)15-9-16(15,5)6/h10-11,13-15H,3,7-9H2,1-2,4-6H3 |
| InChIKey | UPMHLOQIXNWUGB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|